About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol (PubChem CID 3062898) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol |
| PubChem CID | 3062898 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol |
| SMILES | Cc1ccccc1O.NCCNCCNCCN |
| InChI | InChI=1S/C7H8O.C6H18N4/c1-6-4-2-3-5-7(6)8;7-1-3-9-5-6-10-4-2-8/h2-5,8H,1H3;9-10H,1-8H2 |
| InChIKey | ODJPMNXXGZETCA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol (CID 3062898) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol is Cc1ccccc1O.NCCNCCNCCN.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol?
The InChIKey is ODJPMNXXGZETCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H18N4/c1-6-4-2-3-5-7(6)8;7-1-3-9-5-6-10-4-2-8/h2-5,8H,1H3;9-10H,1-8H2.
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol has a molecular weight of 254.38 g/mol, XLogP of -0.22, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;2-methylphenol is sourced from PubChem (CID 3062898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).