C18H19NO7 — CID 3062904
(2S,3R,4S,5R)-2-[4-[(3-nitrophenyl)methyl]phenoxy]oxane-3,4,5-triol (PubChem CID 3062904) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-[(3-nitrophenyl)methyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[4-[(3-nitrophenyl)methyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 3062904 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-[(3-nitrophenyl)methyl]phenoxy]oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cccc(Cc2ccc(O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C18H19NO7/c20-15-10-25-18(17(22)16(15)21)26-14-6-4-11(5-7-14)8-12-2-1-3-13(9-12)19(23)24/h1-7,9,15-18,20-22H,8,10H2/t15-,16+,17-,18+/m1/s1 |
| InChIKey | FAWBZBIXFCVRGY-XDNAFOTISA-N |
| XLogP | 1.00 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|