C13H20N6 — CID 3063051
1-cyano-3-[(1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-yl)methyl]-2-methylguanidine (PubChem CID 3063051) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-cyano-3-[(1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-yl)methyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[(1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 3063051 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 1-cyano-3-[(1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-yl)methyl]-2-methylguanidine |
| SMILES | CCn1cnc2c1CCC(CN/C(=N/C)NC#N)C2 |
| InChI | InChI=1S/C13H20N6/c1-3-19-9-18-11-6-10(4-5-12(11)19)7-16-13(15-2)17-8-14/h9-10H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | AXOPMJFQBCKOCF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|