About 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide
2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide (PubChem CID 3063090) has the molecular formula C8H21Br2N3S
and a molecular weight of 351.15 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide |
| PubChem CID | 3063090 |
| Molecular Formula | C8H21Br2N3S |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide |
| SMILES | Br.Br.C/N=C(\SCCN(C)C)N(C)C |
| InChI | InChI=1S/C8H19N3S.2BrH/c1-9-8(11(4)5)12-7-6-10(2)3;;/h6-7H2,1-5H3;2*1H/b9-8-;; |
| InChIKey | IUFFOWHJHDNFLY-ULDSSAIZSA-N |
| XLogP | 1.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide?
The IUPAC name of 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide (CID 3063090) is 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide.
What is the SMILES notation for 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide?
The canonical SMILES for 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide is Br.Br.C/N=C(\SCCN(C)C)N(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide?
The InChIKey is IUFFOWHJHDNFLY-ULDSSAIZSA-N. The full InChI is InChI=1S/C8H19N3S.2BrH/c1-9-8(11(4)5)12-7-6-10(2)3;;/h6-7H2,1-5H3;2*1H/b9-8-;;.
What are the key properties of 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide?
2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide has a molecular weight of 351.15 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N,N,N'-trimethylcarbamimidothioate;dihydrobromide is sourced from PubChem (CID 3063090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).