About 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile
2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile (PubChem CID 3063140) has the molecular formula C11H9N5O
and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile |
| PubChem CID | 3063140 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile |
| SMILES | CC(C)Oc1nc(N)c(C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C11H9N5O/c1-6(2)17-11-9(5-14)7(3-12)8(4-13)10(15)16-11/h6H,1-2H3,(H2,15,16) |
| InChIKey | KEUYHNCFTDJTHU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile?
The IUPAC name of 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile (CID 3063140) is 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile.
What is the SMILES notation for 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile?
The canonical SMILES for 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile is CC(C)Oc1nc(N)c(C#N)c(C#N)c1C#N.
What is the InChIKey of 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile?
The InChIKey is KEUYHNCFTDJTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O/c1-6(2)17-11-9(5-14)7(3-12)8(4-13)10(15)16-11/h6H,1-2H3,(H2,15,16).
What are the key properties of 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile?
2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile has a molecular weight of 227.23 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-propan-2-yloxypyridine-3,4,5-tricarbonitrile is sourced from PubChem (CID 3063140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).