C15H22O4 — CID 3063200
1-(3,4,5-trihydroxyphenyl)nonan-1-one (PubChem CID 3063200) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(3,4,5-trihydroxyphenyl)nonan-1-one.
| Compound Name | 1-(3,4,5-trihydroxyphenyl)nonan-1-one |
|---|---|
| PubChem CID | 3063200 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-(3,4,5-trihydroxyphenyl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H22O4/c1-2-3-4-5-6-7-8-12(16)11-9-13(17)15(19)14(18)10-11/h9-10,17-19H,2-8H2,1H3 |
| InChIKey | NVFRHTFJDGAFQS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|