C36H38N4O4S — CID 3063309
bis(3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene);sulfate (PubChem CID 3063309) has the molecular formula C36H38N4O4S and a molecular weight of 622.79 g/mol. Its IUPAC name is bis(3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene);sulfate.
| Compound Name | bis(3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene);sulfate |
|---|---|
| PubChem CID | 3063309 |
| Molecular Formula | C36H38N4O4S |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | bis(3-aza-12-azoniapentacyclo[10.7.1.02,10.04,9.016,20]icosa-5,7,11,13,15,18-hexaene);sulfate |
| SMILES | C1=CC2NC3C(C=[N+]4C=CC=C5CC=CC3C54)C2C=C1.C1=CC2NC3C(C=[N+]4C=CC=C5CC=CC3C54)C2C=C1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C18H19N2.H2O4S/c2*1-2-9-16-13(7-1)15-11-20-10-4-6-12-5-3-8-14(18(12)20)17(15)19-16;1-5(2,3)4/h2*1-4,6-11,13-19H,5H2;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | FZOLWIHLIBEHFF-UHFFFAOYSA-L |
| XLogP | 3.02 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|