About 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal
3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal (PubChem CID 3063469) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal.
Molecular Properties
| Compound Name | 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal |
| PubChem CID | 3063469 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal |
| SMILES | CCC(CC)(COc1ccc(N)cc1)C(O)(O)C=O |
| InChI | InChI=1S/C14H21NO4/c1-3-13(4-2,14(17,18)9-16)10-19-12-7-5-11(15)6-8-12/h5-9,17-18H,3-4,10,15H2,1-2H3 |
| InChIKey | LWDBPNKSEBPGMU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal?
The IUPAC name of 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal (CID 3063469) is 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal.
What is the SMILES notation for 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal?
The canonical SMILES for 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal is CCC(CC)(COc1ccc(N)cc1)C(O)(O)C=O.
What is the InChIKey of 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal?
The InChIKey is LWDBPNKSEBPGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-3-13(4-2,14(17,18)9-16)10-19-12-7-5-11(15)6-8-12/h5-9,17-18H,3-4,10,15H2,1-2H3.
What are the key properties of 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal?
3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal has a molecular weight of 267.32 g/mol, XLogP of 1.33, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal is sourced from PubChem (CID 3063469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).