C13H17NO — CID 3063553
1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethanol (PubChem CID 3063553) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethanol.
| Compound Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethanol |
|---|---|
| PubChem CID | 3063553 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethanol |
| SMILES | OCc1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C13H17NO/c15-9-10-7-11-3-1-5-14-6-2-4-12(8-10)13(11)14/h7-8,15H,1-6,9H2 |
| InChIKey | OTRHTQIEJBKBAT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|