C13H18N2 — CID 3063622
(4aR,10bS)-4-methyl-2,3,4a,5,6,10b-hexahydro-1H-4,7-phenanthroline (PubChem CID 3063622) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (4aR,10bS)-4-methyl-2,3,4a,5,6,10b-hexahydro-1H-4,7-phenanthroline.
| Compound Name | (4aR,10bS)-4-methyl-2,3,4a,5,6,10b-hexahydro-1H-4,7-phenanthroline |
|---|---|
| PubChem CID | 3063622 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (4aR,10bS)-4-methyl-2,3,4a,5,6,10b-hexahydro-1H-4,7-phenanthroline |
| SMILES | CN1CCC[C@H]2c3cccnc3CC[C@H]21 |
| InChI | InChI=1S/C13H18N2/c1-15-9-3-5-11-10-4-2-8-14-12(10)6-7-13(11)15/h2,4,8,11,13H,3,5-7,9H2,1H3/t11-,13+/m0/s1 |
| InChIKey | LVNDFGACOZPSFH-WCQYABFASA-N |
| XLogP | 2.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |