About phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone
phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (PubChem CID 3063662) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| PubChem CID | 3063662 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone |
| SMILES | O=C(c1ccccc1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C16H14N2O/c19-16(14-9-5-2-6-10-14)18-15(11-12-17-18)13-7-3-1-4-8-13/h1-10,12,15H,11H2 |
| InChIKey | VATSZXIZOIMIAN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The IUPAC name of phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone (CID 3063662) is phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone.
What is the SMILES notation for phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The canonical SMILES for phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is O=C(c1ccccc1)N1N=CCC1c1ccccc1.
What is the InChIKey of phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
The InChIKey is VATSZXIZOIMIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O/c19-16(14-9-5-2-6-10-14)18-15(11-12-17-18)13-7-3-1-4-8-13/h1-10,12,15H,11H2.
What are the key properties of phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone?
phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone has a molecular weight of 250.30 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(3-phenyl-3,4-dihydropyrazol-2-yl)methanone is sourced from PubChem (CID 3063662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).