C11H10Cl2N2O2 — CID 3063674
3-(2,4-dichlorophenyl)-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 3063674) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 3063674 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN1CCC(=O)N(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C11H10Cl2N2O2/c1-14-5-4-10(16)15(11(14)17)9-3-2-7(12)6-8(9)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | DZXXYRZXCCPOAL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |