About 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one
2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one (PubChem CID 3063813) has the molecular formula C24H14N2O4
and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one |
| PubChem CID | 3063813 |
| Molecular Formula | C24H14N2O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(C(=Cc2ccccc2)c2nc3ccccc3c(=O)o2)nc2ccccc12 |
| InChI | InChI=1S/C24H14N2O4/c27-23-16-10-4-6-12-19(16)25-21(29-23)18(14-15-8-2-1-3-9-15)22-26-20-13-7-5-11-17(20)24(28)30-22/h1-14H |
| InChIKey | DDGBSVKYXNBKCO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one?
The IUPAC name of 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one (CID 3063813) is 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one is O=c1oc(C(=Cc2ccccc2)c2nc3ccccc3c(=O)o2)nc2ccccc12.
What is the InChIKey of 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one?
The InChIKey is DDGBSVKYXNBKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N2O4/c27-23-16-10-4-6-12-19(16)25-21(29-23)18(14-15-8-2-1-3-9-15)22-26-20-13-7-5-11-17(20)24(28)30-22/h1-14H.
What are the key properties of 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one?
2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one has a molecular weight of 394.39 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-oxo-3,1-benzoxazin-2-yl)-2-phenylethenyl]-3,1-benzoxazin-4-one is sourced from PubChem (CID 3063813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).