About 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride
10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride (PubChem CID 3063838) has the molecular formula C16H13ClFN3O
and a molecular weight of 317.75 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride |
| PubChem CID | 3063838 |
| Molecular Formula | C16H13ClFN3O |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2N(c2ccc(F)cc2)C2=NCCN12 |
| InChI | InChI=1S/C16H12FN3O.ClH/c17-11-5-7-12(8-6-11)20-14-4-2-1-3-13(14)15(21)19-10-9-18-16(19)20;/h1-8H,9-10H2;1H |
| InChIKey | PKUKWFHRKOAZHQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride?
The IUPAC name of 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride (CID 3063838) is 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride.
What is the SMILES notation for 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride?
The canonical SMILES for 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride is Cl.O=C1c2ccccc2N(c2ccc(F)cc2)C2=NCCN12.
What is the InChIKey of 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride?
The InChIKey is PKUKWFHRKOAZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3O.ClH/c17-11-5-7-12(8-6-11)20-14-4-2-1-3-13(14)15(21)19-10-9-18-16(19)20;/h1-8H,9-10H2;1H.
What are the key properties of 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride?
10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride has a molecular weight of 317.75 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-fluorophenyl)-2,3-dihydroimidazo[2,1-b]quinazolin-5-one;hydrochloride is sourced from PubChem (CID 3063838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).