C22H25NO4 — CID 3063883
oxalic acid;9-(2-phenylethyl)-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene (PubChem CID 3063883) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is oxalic acid;9-(2-phenylethyl)-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene.
| Compound Name | oxalic acid;9-(2-phenylethyl)-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 3063883 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | oxalic acid;9-(2-phenylethyl)-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene |
| SMILES | O=C(O)C(=O)O.c1ccc(CCN2CCCC3CC2c2ccccc23)cc1 |
| InChI | InChI=1S/C20H23N.C2H2O4/c1-2-7-16(8-3-1)12-14-21-13-6-9-17-15-20(21)19-11-5-4-10-18(17)19;3-1(4)2(5)6/h1-5,7-8,10-11,17,20H,6,9,12-15H2;(H,3,4)(H,5,6) |
| InChIKey | ZWLKJPIQVOUHBB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|