C18H27N3O2 — CID 3063962
5-[bis(prop-2-enyl)amino]-3-cyclohexyl-1,6-dimethylpyrimidine-2,4-dione (PubChem CID 3063962) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 5-[bis(prop-2-enyl)amino]-3-cyclohexyl-1,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[bis(prop-2-enyl)amino]-3-cyclohexyl-1,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3063962 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 5-[bis(prop-2-enyl)amino]-3-cyclohexyl-1,6-dimethylpyrimidine-2,4-dione |
| SMILES | C=CCN(CC=C)c1c(C)n(C)c(=O)n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C18H27N3O2/c1-5-12-20(13-6-2)16-14(3)19(4)18(23)21(17(16)22)15-10-8-7-9-11-15/h5-6,15H,1-2,7-13H2,3-4H3 |
| InChIKey | VKCBSYASCAEHOF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|