About sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine
sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine (PubChem CID 3063995) has the molecular formula C13H27NO4S
and a molecular weight of 293.43 g/mol. Its IUPAC name is sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine |
| PubChem CID | 3063995 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@@H]1CC1CCCCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C13H25N.H2O4S/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;1-5(2,3)4/h11-13H,1-10,14H2;(H2,1,2,3,4)/t12-,13-;/m1./s1 |
| InChIKey | WHVHEUFDRZMJNI-OJERSXHUSA-N |
| XLogP | 2.82 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine?
The IUPAC name of sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine (CID 3063995) is sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine.
What is the SMILES notation for sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine?
The canonical SMILES for sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine is N[C@@H]1CCCC[C@@H]1CC1CCCCC1.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine?
The InChIKey is WHVHEUFDRZMJNI-OJERSXHUSA-N. The full InChI is InChI=1S/C13H25N.H2O4S/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;1-5(2,3)4/h11-13H,1-10,14H2;(H2,1,2,3,4)/t12-,13-;/m1./s1.
What are the key properties of sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine?
sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine has a molecular weight of 293.43 g/mol, XLogP of 2.82, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;trans-(1R,2R)-2-(cyclohexylmethyl)cyclohexan-1-amine is sourced from PubChem (CID 3063995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).