C16H36Br2N2 — CID 3064078
1,4-bis(4-methylpentan-2-yl)piperazine;dihydrobromide (PubChem CID 3064078) has the molecular formula C16H36Br2N2 and a molecular weight of 416.29 g/mol. Its IUPAC name is 1,4-bis(4-methylpentan-2-yl)piperazine;dihydrobromide.
| Compound Name | 1,4-bis(4-methylpentan-2-yl)piperazine;dihydrobromide |
|---|---|
| PubChem CID | 3064078 |
| Molecular Formula | C16H36Br2N2 |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1,4-bis(4-methylpentan-2-yl)piperazine;dihydrobromide |
| SMILES | Br.Br.CC(C)CC(C)N1CCN(C(C)CC(C)C)CC1 |
| InChI | InChI=1S/C16H34N2.2BrH/c1-13(2)11-15(5)17-7-9-18(10-8-17)16(6)12-14(3)4;;/h13-16H,7-12H2,1-6H3;2*1H |
| InChIKey | LGFHRODCMJABLE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |