About 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride
4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride (PubChem CID 3064357) has the molecular formula C20H24ClNO
and a molecular weight of 329.87 g/mol. Its IUPAC name is 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride |
| PubChem CID | 3064357 |
| Molecular Formula | C20H24ClNO |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride |
| SMILES | Cl.OC1(c2ccccc2)CCN([C@@H]2C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23NO.ClH/c22-20(17-9-5-2-6-10-17)11-13-21(14-12-20)19-15-18(19)16-7-3-1-4-8-16;/h1-10,18-19,22H,11-15H2;1H/t18-,19+;/m0./s1 |
| InChIKey | GFGSQVCRIOQGOZ-GRTNUQQKSA-N |
| XLogP | 3.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride?
The IUPAC name of 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride (CID 3064357) is 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride.
What is the SMILES notation for 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride?
The canonical SMILES for 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride is Cl.OC1(c2ccccc2)CCN([C@@H]2C[C@H]2c2ccccc2)CC1.
What is the InChIKey of 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride?
The InChIKey is GFGSQVCRIOQGOZ-GRTNUQQKSA-N. The full InChI is InChI=1S/C20H23NO.ClH/c22-20(17-9-5-2-6-10-17)11-13-21(14-12-20)19-15-18(19)16-7-3-1-4-8-16;/h1-10,18-19,22H,11-15H2;1H/t18-,19+;/m0./s1.
What are the key properties of 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride?
4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride has a molecular weight of 329.87 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-ol;hydrochloride is sourced from PubChem (CID 3064357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).