About 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride
2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride (PubChem CID 3064400) has the molecular formula C12H20ClNO
and a molecular weight of 229.75 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 3064400 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride |
| SMILES | COc1ccc(CCN(C)C)cc1C.Cl |
| InChI | InChI=1S/C12H19NO.ClH/c1-10-9-11(7-8-13(2)3)5-6-12(10)14-4;/h5-6,9H,7-8H2,1-4H3;1H |
| InChIKey | OFALENWRZMFOPJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride (CID 3064400) is 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride is COc1ccc(CCN(C)C)cc1C.Cl.
What is the InChIKey of 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride?
The InChIKey is OFALENWRZMFOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.ClH/c1-10-9-11(7-8-13(2)3)5-6-12(10)14-4;/h5-6,9H,7-8H2,1-4H3;1H.
What are the key properties of 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride?
2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride has a molecular weight of 229.75 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-3-methylphenyl)-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 3064400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).