About 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one
5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3064610) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| PubChem CID | 3064610 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | O=c1cc(N2CCCC2)n2ccsc2n1 |
| InChI | InChI=1S/C10H11N3OS/c14-8-7-9(12-3-1-2-4-12)13-5-6-15-10(13)11-8/h5-7H,1-4H2 |
| InChIKey | AQJFYOTWGWHYPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one?
The IUPAC name of 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one (CID 3064610) is 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
What is the SMILES notation for 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one?
The canonical SMILES for 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one is O=c1cc(N2CCCC2)n2ccsc2n1.
What is the InChIKey of 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one?
The InChIKey is AQJFYOTWGWHYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c14-8-7-9(12-3-1-2-4-12)13-5-6-15-10(13)11-8/h5-7H,1-4H2.
What are the key properties of 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one?
5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one has a molecular weight of 221.28 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-1-yl-[1,3]thiazolo[3,2-a]pyrimidin-7-one is sourced from PubChem (CID 3064610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).