C12H15NOS — CID 3064623
(4aR,11bR)-3,4,4a,5,6,11b-hexahydro-2H-[1]benzothiepino[5,4-b][1,4]oxazine (PubChem CID 3064623) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is (4aR,11bR)-3,4,4a,5,6,11b-hexahydro-2H-[1]benzothiepino[5,4-b][1,4]oxazine.
| Compound Name | (4aR,11bR)-3,4,4a,5,6,11b-hexahydro-2H-[1]benzothiepino[5,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 3064623 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (4aR,11bR)-3,4,4a,5,6,11b-hexahydro-2H-[1]benzothiepino[5,4-b][1,4]oxazine |
| SMILES | c1ccc2c(c1)SCC[C@H]1NCCO[C@H]21 |
| InChI | InChI=1S/C12H15NOS/c1-2-4-11-9(3-1)12-10(5-8-15-11)13-6-7-14-12/h1-4,10,12-13H,5-8H2/t10-,12-/m1/s1 |
| InChIKey | MBQZCDLUSIQFDD-ZYHUDNBSSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |