C19H23N3O2 — CID 3064752
3-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 3064752) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3064752 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CN1C[C@H](CN2CCOC2=O)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C19H23N3O2/c1-21-10-12(11-22-5-6-24-19(22)23)7-15-14-3-2-4-16-18(14)13(9-20-16)8-17(15)21/h2-4,9,12,15,17,20H,5-8,10-11H2,1H3/t12-,15?,17-/m1/s1 |
| InChIKey | IWAYTKOKZODAMR-XURPUJGUSA-N |
| XLogP | 2.58 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |