About 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline
5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline (PubChem CID 3064774) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline.
Molecular Properties
| Compound Name | 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
| PubChem CID | 3064774 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
| SMILES | CC1CN(S(=O)(=O)c2cccc3cnccc23)CCCN1 |
| InChI | InChI=1S/C15H19N3O2S/c1-12-11-18(9-3-7-17-12)21(19,20)15-5-2-4-13-10-16-8-6-14(13)15/h2,4-6,8,10,12,17H,3,7,9,11H2,1H3 |
| InChIKey | PDDYZDBYVDJCNL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The IUPAC name of 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline (CID 3064774) is 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline.
What is the SMILES notation for 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The canonical SMILES for 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline is CC1CN(S(=O)(=O)c2cccc3cnccc23)CCCN1.
What is the InChIKey of 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The InChIKey is PDDYZDBYVDJCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S/c1-12-11-18(9-3-7-17-12)21(19,20)15-5-2-4-13-10-16-8-6-14(13)15/h2,4-6,8,10,12,17H,3,7,9,11H2,1H3.
What are the key properties of 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline has a molecular weight of 305.40 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline is sourced from PubChem (CID 3064774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).