C11H12N2O2 — CID 3064824
5,6-dimethyl-6-phenyl-3H-1,3,4-oxadiazin-2-one (PubChem CID 3064824) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 5,6-dimethyl-6-phenyl-3H-1,3,4-oxadiazin-2-one.
| Compound Name | 5,6-dimethyl-6-phenyl-3H-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 3064824 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 5,6-dimethyl-6-phenyl-3H-1,3,4-oxadiazin-2-one |
| SMILES | CC1=NNC(=O)OC1(C)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O2/c1-8-11(2,15-10(14)13-12-8)9-6-4-3-5-7-9/h3-7H,1-2H3,(H,13,14) |
| InChIKey | CWZAHGNWKZHUDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |