C16H16N6O2 — CID 3064957
3,4,9-trimethyl-1-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 3064957) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3,4,9-trimethyl-1-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 3,4,9-trimethyl-1-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 3064957 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3,4,9-trimethyl-1-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NN(c2ccccc2)c2nc3c(c(=O)[nH]c(=O)n3C)n2C1C |
| InChI | InChI=1S/C16H16N6O2/c1-9-10(2)21-12-13(20(3)16(24)18-14(12)23)17-15(21)22(19-9)11-7-5-4-6-8-11/h4-8,10H,1-3H3,(H,18,23,24) |
| InChIKey | UZXPWOUZKUITTC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |