About 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride
2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride (PubChem CID 3064972) has the molecular formula C12H16ClN3O
and a molecular weight of 253.73 g/mol. Its IUPAC name is 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride |
| PubChem CID | 3064972 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride |
| SMILES | Cc1cc(N2CCCC2)c(C#N)c(C)[n+]1[O-].Cl |
| InChI | InChI=1S/C12H15N3O.ClH/c1-9-7-12(14-5-3-4-6-14)11(8-13)10(2)15(9)16;/h7H,3-6H2,1-2H3;1H |
| InChIKey | UCPKGJASYRYBJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride?
The IUPAC name of 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride (CID 3064972) is 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride.
What is the SMILES notation for 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride?
The canonical SMILES for 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride is Cc1cc(N2CCCC2)c(C#N)c(C)[n+]1[O-].Cl.
What is the InChIKey of 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride?
The InChIKey is UCPKGJASYRYBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O.ClH/c1-9-7-12(14-5-3-4-6-14)11(8-13)10(2)15(9)16;/h7H,3-6H2,1-2H3;1H.
What are the key properties of 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride?
2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride has a molecular weight of 253.73 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1-oxido-4-pyrrolidin-1-ylpyridin-1-ium-3-carbonitrile;hydrochloride is sourced from PubChem (CID 3064972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).