C12H14N4O — CID 3065020
N-[8-(dimethylamino)-1,7-naphthyridin-6-yl]acetamide (PubChem CID 3065020) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[8-(dimethylamino)-1,7-naphthyridin-6-yl]acetamide.
| Compound Name | N-[8-(dimethylamino)-1,7-naphthyridin-6-yl]acetamide |
|---|---|
| PubChem CID | 3065020 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-[8-(dimethylamino)-1,7-naphthyridin-6-yl]acetamide |
| SMILES | CC(=O)Nc1cc2cccnc2c(N(C)C)n1 |
| InChI | InChI=1S/C12H14N4O/c1-8(17)14-10-7-9-5-4-6-13-11(9)12(15-10)16(2)3/h4-7H,1-3H3,(H,14,15,17) |
| InChIKey | GCHCPCAPWODONJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |