About 1-decyl-2,5-dimethylpiperazine
1-decyl-2,5-dimethylpiperazine (PubChem CID 3065171) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 1-decyl-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-decyl-2,5-dimethylpiperazine |
| PubChem CID | 3065171 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 1-decyl-2,5-dimethylpiperazine |
| SMILES | CCCCCCCCCCN1CC(C)NCC1C |
| InChI | InChI=1S/C16H34N2/c1-4-5-6-7-8-9-10-11-12-18-14-15(2)17-13-16(18)3/h15-17H,4-14H2,1-3H3 |
| InChIKey | SDGRGWFZYSKPCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-2,5-dimethylpiperazine?
The IUPAC name of 1-decyl-2,5-dimethylpiperazine (CID 3065171) is 1-decyl-2,5-dimethylpiperazine.
What is the SMILES notation for 1-decyl-2,5-dimethylpiperazine?
The canonical SMILES for 1-decyl-2,5-dimethylpiperazine is CCCCCCCCCCN1CC(C)NCC1C.
What is the InChIKey of 1-decyl-2,5-dimethylpiperazine?
The InChIKey is SDGRGWFZYSKPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2/c1-4-5-6-7-8-9-10-11-12-18-14-15(2)17-13-16(18)3/h15-17H,4-14H2,1-3H3.
What are the key properties of 1-decyl-2,5-dimethylpiperazine?
1-decyl-2,5-dimethylpiperazine has a molecular weight of 254.46 g/mol, XLogP of 3.81, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-2,5-dimethylpiperazine is sourced from PubChem (CID 3065171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).