About 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide
3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 3065264) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| PubChem CID | 3065264 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CCN1CCCCC1 |
| InChI | InChI=1S/C16H32N2O/c1-15(2,3)13-16(4,5)17-14(19)9-12-18-10-7-6-8-11-18/h6-13H2,1-5H3,(H,17,19) |
| InChIKey | ZLOJCRXWOPWQOA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The IUPAC name of 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide (CID 3065264) is 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
What is the SMILES notation for 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The canonical SMILES for 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide is CC(C)(C)CC(C)(C)NC(=O)CCN1CCCCC1.
What is the InChIKey of 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The InChIKey is ZLOJCRXWOPWQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O/c1-15(2,3)13-16(4,5)17-14(19)9-12-18-10-7-6-8-11-18/h6-13H2,1-5H3,(H,17,19).
What are the key properties of 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide?
3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide has a molecular weight of 268.44 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide is sourced from PubChem (CID 3065264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).