About 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one
1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one (PubChem CID 3065277) has the molecular formula C22H13N5O5
and a molecular weight of 427.38 g/mol. Its IUPAC name is 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one.
Molecular Properties
| Compound Name | 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one |
| PubChem CID | 3065277 |
| Molecular Formula | C22H13N5O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one |
| SMILES | O=c1c2ccccc2nc2n(-c3ccc([N+](=O)[O-])cc3)cc(-c3ccc([N+](=O)[O-])cc3)n12 |
| InChI | InChI=1S/C22H13N5O5/c28-21-18-3-1-2-4-19(18)23-22-24(15-9-11-17(12-10-15)27(31)32)13-20(25(21)22)14-5-7-16(8-6-14)26(29)30/h1-13H |
| InChIKey | ZWLIXBKPEPYQBD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 125.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one?
The IUPAC name of 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one (CID 3065277) is 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one.
What is the SMILES notation for 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one?
The canonical SMILES for 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one is O=c1c2ccccc2nc2n(-c3ccc([N+](=O)[O-])cc3)cc(-c3ccc([N+](=O)[O-])cc3)n12.
What is the InChIKey of 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one?
The InChIKey is ZWLIXBKPEPYQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N5O5/c28-21-18-3-1-2-4-19(18)23-22-24(15-9-11-17(12-10-15)27(31)32)13-20(25(21)22)14-5-7-16(8-6-14)26(29)30/h1-13H.
What are the key properties of 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one?
1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one has a molecular weight of 427.38 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-nitrophenyl)imidazo[2,1-b]quinazolin-5-one is sourced from PubChem (CID 3065277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).