About 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate
2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate (PubChem CID 3065355) has the molecular formula C15H26N4O3S
and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate |
| PubChem CID | 3065355 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate |
| SMILES | CCN(CC)CCOC(=O)CCC(=O)Nc1nnc(C(C)C)s1 |
| InChI | InChI=1S/C15H26N4O3S/c1-5-19(6-2)9-10-22-13(21)8-7-12(20)16-15-18-17-14(23-15)11(3)4/h11H,5-10H2,1-4H3,(H,16,18,20) |
| InChIKey | BXUFTUOIOLHFFU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate?
The IUPAC name of 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate (CID 3065355) is 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate?
The canonical SMILES for 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate is CCN(CC)CCOC(=O)CCC(=O)Nc1nnc(C(C)C)s1.
What is the InChIKey of 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate?
The InChIKey is BXUFTUOIOLHFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O3S/c1-5-19(6-2)9-10-22-13(21)8-7-12(20)16-15-18-17-14(23-15)11(3)4/h11H,5-10H2,1-4H3,(H,16,18,20).
What are the key properties of 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate?
2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate has a molecular weight of 342.47 g/mol, XLogP of 2.27, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4-oxo-4-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]butanoate is sourced from PubChem (CID 3065355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).