About benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+)
benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) (PubChem CID 3065513) has the molecular formula C13H16N2O4Pt
and a molecular weight of 459.36 g/mol. Its IUPAC name is benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+).
Molecular Properties
| Compound Name | benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) |
| PubChem CID | 3065513 |
| Molecular Formula | C13H16N2O4Pt |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) |
| SMILES | NC1CCCC1N.O=C([O-])c1cccc(C(=O)[O-])c1.[Pt+2] |
| InChI | InChI=1S/C8H6O4.C5H12N2.Pt/c9-7(10)5-2-1-3-6(4-5)8(11)12;6-4-2-1-3-5(4)7;/h1-4H,(H,9,10)(H,11,12);4-5H,1-3,6-7H2;/q;;+2/p-2 |
| InChIKey | YQGXSYZYMOLARA-UHFFFAOYSA-L |
| XLogP | -1.76 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+)?
The IUPAC name of benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) (CID 3065513) is benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+).
What is the SMILES notation for benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+)?
The canonical SMILES for benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) is NC1CCCC1N.O=C([O-])c1cccc(C(=O)[O-])c1.[Pt+2].
What is the InChIKey of benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+)?
The InChIKey is YQGXSYZYMOLARA-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.C5H12N2.Pt/c9-7(10)5-2-1-3-6(4-5)8(11)12;6-4-2-1-3-5(4)7;/h1-4H,(H,9,10)(H,11,12);4-5H,1-3,6-7H2;/q;;+2/p-2.
What are the key properties of benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+)?
benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) has a molecular weight of 459.36 g/mol, XLogP of -1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dicarboxylate;cyclopentane-1,2-diamine;platinum(2+) is sourced from PubChem (CID 3065513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).