C14H16N2O6Pt — CID 3065636
benzene-1,3,5-tricarboxylate;cyclopentane-1,2-diamine;hydron;platinum(2+) (PubChem CID 3065636) has the molecular formula C14H16N2O6Pt and a molecular weight of 503.37 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylate;cyclopentane-1,2-diamine;hydron;platinum(2+).
| Compound Name | benzene-1,3,5-tricarboxylate;cyclopentane-1,2-diamine;hydron;platinum(2+) |
|---|---|
| PubChem CID | 3065636 |
| Molecular Formula | C14H16N2O6Pt |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | benzene-1,3,5-tricarboxylate;cyclopentane-1,2-diamine;hydron;platinum(2+) |
| SMILES | NC1CCCC1N.O=C([O-])c1cc(C(=O)[O-])cc(C(=O)[O-])c1.[H+].[Pt+2] |
| InChI | InChI=1S/C9H6O6.C5H12N2.Pt/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;6-4-2-1-3-5(4)7;/h1-3H,(H,10,11)(H,12,13)(H,14,15);4-5H,1-3,6-7H2;/q;;+2/p-2 |
| InChIKey | SWBPPBHYQJEXQV-UHFFFAOYSA-L |
| XLogP | -3.29 |
| TPSA | 172.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |