About 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane
2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane (PubChem CID 3065689) has the molecular formula C20H28O3Si
and a molecular weight of 344.53 g/mol. Its IUPAC name is 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane |
| PubChem CID | 3065689 |
| Molecular Formula | C20H28O3Si |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane |
| SMILES | CCCCC12COC(c3ccc(C#C[Si](C)(C)C)cc3)(OC1)OC2 |
| InChI | InChI=1S/C20H28O3Si/c1-5-6-12-19-14-21-20(22-15-19,23-16-19)18-9-7-17(8-10-18)11-13-24(2,3)4/h7-10H,5-6,12,14-16H2,1-4H3 |
| InChIKey | KCDKPDPNGLWGNF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane?
The IUPAC name of 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane (CID 3065689) is 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane is CCCCC12COC(c3ccc(C#C[Si](C)(C)C)cc3)(OC1)OC2.
What is the InChIKey of 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane?
The InChIKey is KCDKPDPNGLWGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O3Si/c1-5-6-12-19-14-21-20(22-15-19,23-16-19)18-9-7-17(8-10-18)11-13-24(2,3)4/h7-10H,5-6,12,14-16H2,1-4H3.
What are the key properties of 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane?
2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane has a molecular weight of 344.53 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-butyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)phenyl]ethynyl-trimethylsilane is sourced from PubChem (CID 3065689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).