C9H8O4 — CID 3065930
8,11-dioxatetracyclo[4.3.1.12,5.01,6]undecane-7,9-dione (PubChem CID 3065930) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 8,11-dioxatetracyclo[4.3.1.12,5.01,6]undecane-7,9-dione.
| Compound Name | 8,11-dioxatetracyclo[4.3.1.12,5.01,6]undecane-7,9-dione |
|---|---|
| PubChem CID | 3065930 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 8,11-dioxatetracyclo[4.3.1.12,5.01,6]undecane-7,9-dione |
| SMILES | O=C1OC(=O)C23CC12C1CCC3O1 |
| InChI | InChI=1S/C9H8O4/c10-6-8-3-9(8,7(11)13-6)5-2-1-4(8)12-5/h4-5H,1-3H2 |
| InChIKey | LYHNUBGRBFVDSE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|