C14H10ClN3O2 — CID 3066027
1-(2-chlorophenyl)-2-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 3066027) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-(2-chlorophenyl)-2-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 3066027 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(2-chlorophenyl)-2-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-11-8-4-5-9-12(11)18-14(20)16-13(19)17(18)10-6-2-1-3-7-10/h1-9H,(H,16,19,20) |
| InChIKey | QKKZCWVTUWUULQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |