About 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride
2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride (PubChem CID 3066075) has the molecular formula C22H30ClNO
and a molecular weight of 359.94 g/mol. Its IUPAC name is 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride |
| PubChem CID | 3066075 |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride |
| SMILES | CN1CCOC(C)(c2ccc(C3CCCCC3)c3ccccc23)C1.Cl |
| InChI | InChI=1S/C22H29NO.ClH/c1-22(16-23(2)14-15-24-22)21-13-12-18(17-8-4-3-5-9-17)19-10-6-7-11-20(19)21;/h6-7,10-13,17H,3-5,8-9,14-16H2,1-2H3;1H |
| InChIKey | QGBWDJQUEUNACX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride?
The IUPAC name of 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride (CID 3066075) is 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride.
What is the SMILES notation for 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride?
The canonical SMILES for 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride is CN1CCOC(C)(c2ccc(C3CCCCC3)c3ccccc23)C1.Cl.
What is the InChIKey of 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride?
The InChIKey is QGBWDJQUEUNACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO.ClH/c1-22(16-23(2)14-15-24-22)21-13-12-18(17-8-4-3-5-9-17)19-10-6-7-11-20(19)21;/h6-7,10-13,17H,3-5,8-9,14-16H2,1-2H3;1H.
What are the key properties of 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride?
2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride has a molecular weight of 359.94 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexylnaphthalen-1-yl)-2,4-dimethylmorpholine;hydrochloride is sourced from PubChem (CID 3066075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).