About 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride
2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride (PubChem CID 3066128) has the molecular formula C11H9ClN2S
and a molecular weight of 236.73 g/mol. Its IUPAC name is 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride |
| PubChem CID | 3066128 |
| Molecular Formula | C11H9ClN2S |
| Molecular Weight | 236.73 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride |
| SMILES | Cc1nc2cnc3ccccc3c2s1.Cl |
| InChI | InChI=1S/C11H8N2S.ClH/c1-7-13-10-6-12-9-5-3-2-4-8(9)11(10)14-7;/h2-6H,1H3;1H |
| InChIKey | CXWXIRAMNONJHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride?
The IUPAC name of 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride (CID 3066128) is 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride.
What is the SMILES notation for 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride?
The canonical SMILES for 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride is Cc1nc2cnc3ccccc3c2s1.Cl.
What is the InChIKey of 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride?
The InChIKey is CXWXIRAMNONJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S.ClH/c1-7-13-10-6-12-9-5-3-2-4-8(9)11(10)14-7;/h2-6H,1H3;1H.
What are the key properties of 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride?
2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride has a molecular weight of 236.73 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-[1,3]thiazolo[4,5-c]quinoline;hydrochloride is sourced from PubChem (CID 3066128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).