About N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride
N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride (PubChem CID 3066159) has the molecular formula C15H31ClN2O
and a molecular weight of 290.88 g/mol. Its IUPAC name is N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride |
| PubChem CID | 3066159 |
| Molecular Formula | C15H31ClN2O |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride |
| SMILES | CC(C)CCC(C)(C)NC(=O)CN1CCCCC1.Cl |
| InChI | InChI=1S/C15H30N2O.ClH/c1-13(2)8-9-15(3,4)16-14(18)12-17-10-6-5-7-11-17;/h13H,5-12H2,1-4H3,(H,16,18);1H |
| InChIKey | DZHFKLQDEMGCGR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride?
The IUPAC name of N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride (CID 3066159) is N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride.
What is the SMILES notation for N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride?
The canonical SMILES for N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride is CC(C)CCC(C)(C)NC(=O)CN1CCCCC1.Cl.
What is the InChIKey of N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride?
The InChIKey is DZHFKLQDEMGCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O.ClH/c1-13(2)8-9-15(3,4)16-14(18)12-17-10-6-5-7-11-17;/h13H,5-12H2,1-4H3,(H,16,18);1H.
What are the key properties of N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride?
N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride has a molecular weight of 290.88 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylhexan-2-yl)-2-piperidin-1-ylacetamide;hydrochloride is sourced from PubChem (CID 3066159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).