About 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine
4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine (PubChem CID 3066176) has the molecular formula C17H24N4O2
and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine |
| PubChem CID | 3066176 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine |
| SMILES | Nc1ccc(OCCCCCOc2ccc(N)c(N)c2)cc1N |
| InChI | InChI=1S/C17H24N4O2/c18-14-6-4-12(10-16(14)20)22-8-2-1-3-9-23-13-5-7-15(19)17(21)11-13/h4-7,10-11H,1-3,8-9,18-21H2 |
| InChIKey | JVJALUWIKDCMKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine?
The IUPAC name of 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine (CID 3066176) is 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine.
What is the SMILES notation for 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine?
The canonical SMILES for 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine is Nc1ccc(OCCCCCOc2ccc(N)c(N)c2)cc1N.
What is the InChIKey of 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine?
The InChIKey is JVJALUWIKDCMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2/c18-14-6-4-12(10-16(14)20)22-8-2-1-3-9-23-13-5-7-15(19)17(21)11-13/h4-7,10-11H,1-3,8-9,18-21H2.
What are the key properties of 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine?
4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine has a molecular weight of 316.41 g/mol, XLogP of 2.64, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,4-diaminophenoxy)pentoxy]benzene-1,2-diamine is sourced from PubChem (CID 3066176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).