About 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride
2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride (PubChem CID 3066192) has the molecular formula C15H31ClN2O2
and a molecular weight of 306.88 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride |
| PubChem CID | 3066192 |
| Molecular Formula | C15H31ClN2O2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride |
| SMILES | CC(C(=O)NC(C)(C)CC(C)(C)C)N1CCOCC1.Cl |
| InChI | InChI=1S/C15H30N2O2.ClH/c1-12(17-7-9-19-10-8-17)13(18)16-15(5,6)11-14(2,3)4;/h12H,7-11H2,1-6H3,(H,16,18);1H |
| InChIKey | SSVCLLXQGUOGJR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The IUPAC name of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride (CID 3066192) is 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride.
What is the SMILES notation for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The canonical SMILES for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride is CC(C(=O)NC(C)(C)CC(C)(C)C)N1CCOCC1.Cl.
What is the InChIKey of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
The InChIKey is SSVCLLXQGUOGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2.ClH/c1-12(17-7-9-19-10-8-17)13(18)16-15(5,6)11-14(2,3)4;/h12H,7-11H2,1-6H3,(H,16,18);1H.
What are the key properties of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride?
2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride has a molecular weight of 306.88 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)propanamide;hydrochloride is sourced from PubChem (CID 3066192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).