About 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride
5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 3066288) has the molecular formula C14H20ClN
and a molecular weight of 237.77 g/mol. Its IUPAC name is 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride |
| PubChem CID | 3066288 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | CC(C)N1CCC=C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H19N.ClH/c1-12(2)15-10-6-9-14(11-15)13-7-4-3-5-8-13;/h3-5,7-9,12H,6,10-11H2,1-2H3;1H |
| InChIKey | JRSYYSWPGBBNOM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride?
The IUPAC name of 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride (CID 3066288) is 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride.
What is the SMILES notation for 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride?
The canonical SMILES for 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride is CC(C)N1CCC=C(c2ccccc2)C1.Cl.
What is the InChIKey of 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride?
The InChIKey is JRSYYSWPGBBNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N.ClH/c1-12(2)15-10-6-9-14(11-15)13-7-4-3-5-8-13;/h3-5,7-9,12H,6,10-11H2,1-2H3;1H.
What are the key properties of 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride?
5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride has a molecular weight of 237.77 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1-propan-2-yl-3,6-dihydro-2H-pyridine;hydrochloride is sourced from PubChem (CID 3066288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).