C24H23N3O3S3 — CID 30665341
4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile (PubChem CID 30665341) has the molecular formula C24H23N3O3S3 and a molecular weight of 497.67 g/mol. Its IUPAC name is 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile.
| Compound Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile |
|---|---|
| PubChem CID | 30665341 |
| Molecular Formula | C24H23N3O3S3 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 4-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-2-yl]sulfanylbutanenitrile |
| SMILES | COc1ccc(CCn2c(SCCCC#N)nc3scc(-c4cccs4)c3c2=O)cc1OC |
| InChI | InChI=1S/C24H23N3O3S3/c1-29-18-8-7-16(14-19(18)30-2)9-11-27-23(28)21-17(20-6-5-13-31-20)15-33-22(21)26-24(27)32-12-4-3-10-25/h5-8,13-15H,3-4,9,11-12H2,1-2H3 |
| InChIKey | IDTWYDJACCIDRL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|