C14H24N2O — CID 3066543
N-tert-butyl-4-(2,5-dimethylpyrrol-1-yl)butanamide (PubChem CID 3066543) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-tert-butyl-4-(2,5-dimethylpyrrol-1-yl)butanamide.
| Compound Name | N-tert-butyl-4-(2,5-dimethylpyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 3066543 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-tert-butyl-4-(2,5-dimethylpyrrol-1-yl)butanamide |
| SMILES | Cc1ccc(C)n1CCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H24N2O/c1-11-8-9-12(2)16(11)10-6-7-13(17)15-14(3,4)5/h8-9H,6-7,10H2,1-5H3,(H,15,17) |
| InChIKey | WZIAFZVCSGBPJQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |