C24H29N3O3 — CID 30665525
(E)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-1-oxopropan-2-yl]prop-2-enamide (PubChem CID 30665525) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-1-oxopropan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-1-oxopropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 30665525 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-1-oxopropan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H](C)C(=O)N2CCN(C)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-18(25-23(28)14-11-19-9-12-21(30-3)13-10-19)24(29)27-16-15-26(2)17-22(27)20-7-5-4-6-8-20/h4-14,18,22H,15-17H2,1-3H3,(H,25,28)/b14-11+/t18-,22+/m0/s1 |
| InChIKey | WVZJQNZRHVCHDI-NOZTZVSSSA-N |
| XLogP | 2.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|