About tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate
tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate (PubChem CID 30666653) has the molecular formula C16H26N4O4
and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate |
| PubChem CID | 30666653 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate |
| SMILES | Cc1cc(NC(=O)CN2CCN(CC(=O)OC(C)(C)C)CC2)no1 |
| InChI | InChI=1S/C16H26N4O4/c1-12-9-13(18-24-12)17-14(21)10-19-5-7-20(8-6-19)11-15(22)23-16(2,3)4/h9H,5-8,10-11H2,1-4H3,(H,17,18,21) |
| InChIKey | AMQRTTJEOVDXIJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate?
The IUPAC name of tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate (CID 30666653) is tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate is Cc1cc(NC(=O)CN2CCN(CC(=O)OC(C)(C)C)CC2)no1.
What is the InChIKey of tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate?
The InChIKey is AMQRTTJEOVDXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O4/c1-12-9-13(18-24-12)17-14(21)10-19-5-7-20(8-6-19)11-15(22)23-16(2,3)4/h9H,5-8,10-11H2,1-4H3,(H,17,18,21).
What are the key properties of tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate?
tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate has a molecular weight of 338.41 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]piperazin-1-yl]acetate is sourced from PubChem (CID 30666653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).