About 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate
4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate (PubChem CID 3066678) has the molecular formula C10H14ClNO6S
and a molecular weight of 311.74 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate |
| PubChem CID | 3066678 |
| Molecular Formula | C10H14ClNO6S |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate |
| SMILES | C[S+](C)CC#CCN1C(=O)CCC1=O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C10H14NO2S.ClHO4/c1-14(2)8-4-3-7-11-9(12)5-6-10(11)13;2-1(3,4)5/h5-8H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | FCJVTSOLKFHFLA-UHFFFAOYSA-M |
| XLogP | -4.74 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate?
The IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate (CID 3066678) is 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate.
What is the SMILES notation for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate?
The canonical SMILES for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate is C[S+](C)CC#CCN1C(=O)CCC1=O.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate?
The InChIKey is FCJVTSOLKFHFLA-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14NO2S.ClHO4/c1-14(2)8-4-3-7-11-9(12)5-6-10(11)13;2-1(3,4)5/h5-8H2,1-2H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate?
4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate has a molecular weight of 311.74 g/mol, XLogP of -4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium perchlorate is sourced from PubChem (CID 3066678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).