C15H23NO5 — CID 3066700
dimethyl 2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)but-2-enedioate (PubChem CID 3066700) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is dimethyl 2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)but-2-enedioate.
| Compound Name | dimethyl 2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 3066700 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | dimethyl 2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)but-2-enedioate |
| SMILES | COC(=O)C=C(C(=O)OC)N1C(C)(C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C15H23NO5/c1-14(2)8-10(17)9-15(3,4)16(14)11(13(19)21-6)7-12(18)20-5/h7H,8-9H2,1-6H3 |
| InChIKey | XGXAVNHACSQRHY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|