About 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride
4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride (PubChem CID 3066879) has the molecular formula C13H18ClN3
and a molecular weight of 251.76 g/mol. Its IUPAC name is 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride |
| PubChem CID | 3066879 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride |
| SMILES | CCCCN1C2=NCCN2c2ccccc21.Cl |
| InChI | InChI=1S/C13H17N3.ClH/c1-2-3-9-15-11-6-4-5-7-12(11)16-10-8-14-13(15)16;/h4-7H,2-3,8-10H2,1H3;1H |
| InChIKey | SWZLVAXPWDHRHF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The IUPAC name of 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride (CID 3066879) is 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride.
What is the SMILES notation for 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The canonical SMILES for 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride is CCCCN1C2=NCCN2c2ccccc21.Cl.
What is the InChIKey of 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
The InChIKey is SWZLVAXPWDHRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3.ClH/c1-2-3-9-15-11-6-4-5-7-12(11)16-10-8-14-13(15)16;/h4-7H,2-3,8-10H2,1H3;1H.
What are the key properties of 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride?
4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride has a molecular weight of 251.76 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,2-dihydroimidazo[1,2-a]benzimidazole;hydrochloride is sourced from PubChem (CID 3066879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).